Lesson · 40 min · Free
Molecular Representation Lab
Molecular Representation Lab body { font-family: sans-serif; line-height: 1.6; margin: 20px; } h1 { color: #2c3e50; } h2 { color: #34495e; border-bottom: 2px solid #ccc; padding-bottom: 5px; margin-top: 30px; } p { margi
Molecular Representation Lab
Welcome to the Molecular Representation Lab, an essential component of your Introduction to Pharmacology course. As future pharmacists and biotech professionals, understanding how drug molecules are represented and manipulated computationally is paramount. This lab will introduce you to standard molecular data formats and tools that facilitate the storage, exchange, and analysis of chemical structures, which are foundational for rational drug design, virtual screening, and pharmacoinformatics. The ability to accurately represent a molecule in a digital format allows for complex computations, predictions of physicochemical properties, and simulations of molecular interactions. We will focus on two widely used linear notations: SMILES (Simplified Molecular-Input Line-Entry System) and InChI (International Chemical Identifier), and briefly touch upon structural file formats like MOL2 and SDF.
Linear Notations: SMILES and InChI
Linear notations provide a way to describe molecular structures using a simple string of characters. This is incredibly useful for databases, search engines, and programmatic manipulation of chemical data. They offer a compact representation compared to graphical depictions or complex connection tables.
SMILES (Simplified Molecular-Input Line-Entry System)
SMILES is a specification for unambiguously describing the structure of chemical molecules using short ASCII strings. It's intuitive and human-readable to some extent. Key features include: Atoms are represented by their atomic symbols (e.g., C, O, N). Hydrogens are usually implicit. Double and triple bonds are represented by '=' and '#' respectively. Branches are indicated by parentheses. Rings are denoted by numbers following the atoms that form the ring closure. Stereochemistry can be specified using special characters (e.g., '@' for chiral centers, '/' and '\' for double bond geometry). Let's look at an example. Consider ethanol: CCO This simple string represents a carbon atom (C) bonded to another carbon atom (C), which is then bonded to an oxygen atom (O). The implicit hydrogens are automatically inferred by chemical software. Now, for a slightly more complex molecule, aspirin (acetylsalicylic acid): CC(=O)Oc1ccccc1C(=O)O Breaking this down: CC(=O)O : Represents an acetate group (CH3-C(=O)-O-) c1ccccc1 : Represents a benzene ring (the 'c' indicates aromatic carbons, '1' denotes ring closure) C(=O)O : Represents a carboxylic acid group (-C(=O)-OH) The benzene ring is substituted with an acetate group and a carboxylic acid group.
InChI (International Chemical Identifier)
InChI is a non-proprietary identifier for chemical substances, designed to be unique, searchable, and machine-readable. Unlike SMILES, which can have multiple valid representations for the same molecule (though canonical SMILES aims for uniqueness), InChI is designed to be a unique identifier for a given chemical structure. It's often used in databases for precise identification. An InChI string is structured into layers, each providing specific information about the molecule (e.g., connectivity, tautomerism, stereochemistry, isotopic enrichment). This hierarchical structure makes it very robust. Example for ethanol: InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3 And for aspirin: InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) While less human-readable than SMILES, InChI's strength lies in its standardization and unique identification capabilities, making it invaluable for data interoperability across different chemical databases.
Structural File Formats (Brief Mention)
Beyond linear notations, molecules are often stored in more detailed structural file formats that include 3D coordinates, bond orders, and atom properties. Common examples include: MOL/SDF (Structure-Data File): Widely used for storing single or multiple chemical structures along with associated data. They contain atom connectivity, bond types, and optionally 3D coordinates. PDB (Protein Data Bank): Primarily used for macromolecules like proteins and nucleic acids, but can also store small molecules (ligands) bound to them. Contains atomic coordinates and other structural information. These formats are crucial for molecular visualization, docking simulations, and other computational chemistry tasks where 3D structure is paramount.
Key Takeaways
SMILES provides a compact, human-readable linear notation for molecular structures, useful for input and simple representation. InChI is a standardized, unique, and layered identifier for chemical structures, crucial for database interoperability and precise identification. Both notations allow for programmatic manipulation and storage of chemical information without requiring graphical files. Understanding these representations is fundamental for working with chemical databases, cheminformatics tools, and computational drug discovery workflows. More complex 3D information is typically stored in formats like MOL/SDF or PDB.
Practice Exercise
Using an online SMILES/InChI converter (e.g., PubChem's Structure Search or ChemDraw/MarvinSketch if available), find the SMILES string and the InChI string for the following two common drug molecules: Paracetamol (Acetaminophen) Caffeine Briefly describe one structural feature you can identify in the SMILES string for each molecule (e.g., ring, functional group, branching). Why might a pharmacologist prefer using InChI over SMILES when querying a large chemical database for a specific compound?
Watch the full lesson — free
This topic is part of Introduction to Pharmacology, a complete AI-narrated video course. Press play once and watch the entire lecture like a movie.
Start the course free →